C25H24N6OS — CID 44525057
N-[2-[[4-[5-(1H-benzimidazol-2-yl)thiophen-2-yl]phenyl]methylamino]ethyl]-2-methylpyrazole-3-carboxamide (PubChem CID 44525057) has the molecular formula C25H24N6OS and a molecular weight of 456.58 g/mol. Its IUPAC name is N-[2-[[4-[5-(1H-benzimidazol-2-yl)thiophen-2-yl]phenyl]methylamino]ethyl]-2-methylpyrazole-3-carboxamide.
| Compound Name | N-[2-[[4-[5-(1H-benzimidazol-2-yl)thiophen-2-yl]phenyl]methylamino]ethyl]-2-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 44525057 |
| Molecular Formula | C25H24N6OS |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | N-[2-[[4-[5-(1H-benzimidazol-2-yl)thiophen-2-yl]phenyl]methylamino]ethyl]-2-methylpyrazole-3-carboxamide |
| SMILES | Cn1nccc1C(=O)NCCNCc1ccc(-c2ccc(-c3nc4ccccc4[nH]3)s2)cc1 |
| InChI | InChI=1S/C25H24N6OS/c1-31-21(12-13-28-31)25(32)27-15-14-26-16-17-6-8-18(9-7-17)22-10-11-23(33-22)24-29-19-4-2-3-5-20(19)30-24/h2-13,26H,14-16H2,1H3,(H,27,32)(H,29,30) |
| InChIKey | WOZAXQWRUJXNRT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|