C22H26N6O2 — CID 44525972
1-(2,5-dimethylphenyl)-3-[2-[[2-(4-methoxyanilino)pyrimidin-4-yl]amino]ethyl]urea (PubChem CID 44525972) has the molecular formula C22H26N6O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-3-[2-[[2-(4-methoxyanilino)pyrimidin-4-yl]amino]ethyl]urea.
| Compound Name | 1-(2,5-dimethylphenyl)-3-[2-[[2-(4-methoxyanilino)pyrimidin-4-yl]amino]ethyl]urea |
|---|---|
| PubChem CID | 44525972 |
| Molecular Formula | C22H26N6O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-3-[2-[[2-(4-methoxyanilino)pyrimidin-4-yl]amino]ethyl]urea |
| SMILES | COc1ccc(Nc2nccc(NCCNC(=O)Nc3cc(C)ccc3C)n2)cc1 |
| InChI | InChI=1S/C22H26N6O2/c1-15-4-5-16(2)19(14-15)27-22(29)25-13-12-23-20-10-11-24-21(28-20)26-17-6-8-18(30-3)9-7-17/h4-11,14H,12-13H2,1-3H3,(H2,25,27,29)(H2,23,24,26,28) |
| InChIKey | ASVFUSBFLIRNDE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 100.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|