C25H31FN4O3 — CID 44529415
N-[(2S)-1-[[(1E,2S)-1-(acetylhydrazinylidene)-4-phenylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-4-fluorobenzamide (PubChem CID 44529415) has the molecular formula C25H31FN4O3 and a molecular weight of 454.55 g/mol. Its IUPAC name is N-[(2S)-1-[[(1E,2S)-1-(acetylhydrazinylidene)-4-phenylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-4-fluorobenzamide.
| Compound Name | N-[(2S)-1-[[(1E,2S)-1-(acetylhydrazinylidene)-4-phenylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 44529415 |
| Molecular Formula | C25H31FN4O3 |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | N-[(2S)-1-[[(1E,2S)-1-(acetylhydrazinylidene)-4-phenylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-4-fluorobenzamide |
| SMILES | CC(=O)N/N=C/[C@H](CCc1ccccc1)NC(=O)[C@H](CC(C)C)NC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H31FN4O3/c1-17(2)15-23(29-24(32)20-10-12-21(26)13-11-20)25(33)28-22(16-27-30-18(3)31)14-9-19-7-5-4-6-8-19/h4-8,10-13,16-17,22-23H,9,14-15H2,1-3H3,(H,28,33)(H,29,32)(H,30,31)/b27-16+/t22-,23-/m0/s1 |
| InChIKey | XMPWBRRLTWCKLL-NONDXZSFSA-N |
| XLogP | 3.21 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|