C24H21F3N6O — CID 44530384
4-[5-amino-1-[6-methyl-4-(trifluoromethyl)-2-pyridinyl]pyrazol-4-yl]-N-[(2-aminophenyl)methyl]benzamide (PubChem CID 44530384) has the molecular formula C24H21F3N6O and a molecular weight of 466.47 g/mol. Its IUPAC name is 4-[5-amino-1-[6-methyl-4-(trifluoromethyl)-2-pyridinyl]pyrazol-4-yl]-N-[(2-aminophenyl)methyl]benzamide.
| Compound Name | 4-[5-amino-1-[6-methyl-4-(trifluoromethyl)-2-pyridinyl]pyrazol-4-yl]-N-[(2-aminophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 44530384 |
| Molecular Formula | C24H21F3N6O |
| Molecular Weight | 466.47 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 4-[5-amino-1-[6-methyl-4-(trifluoromethyl)-2-pyridinyl]pyrazol-4-yl]-N-[(2-aminophenyl)methyl]benzamide |
| SMILES | Cc1cc(C(F)(F)F)cc(-n2ncc(-c3ccc(C(=O)NCc4ccccc4N)cc3)c2N)n1 |
| InChI | InChI=1S/C24H21F3N6O/c1-14-10-18(24(25,26)27)11-21(32-14)33-22(29)19(13-31-33)15-6-8-16(9-7-15)23(34)30-12-17-4-2-3-5-20(17)28/h2-11,13H,12,28-29H2,1H3,(H,30,34) |
| InChIKey | STWRZGSBWIOOPX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|