C20H19N5O2 — CID 44531029
6-[(3aR,7aS)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]-2-(4-nitrophenyl)-1H-benzimidazole (PubChem CID 44531029) has the molecular formula C20H19N5O2 and a molecular weight of 361.41 g/mol. Its IUPAC name is 6-[(3aR,7aS)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]-2-(4-nitrophenyl)-1H-benzimidazole.
| Compound Name | 6-[(3aR,7aS)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]-2-(4-nitrophenyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 44531029 |
| Molecular Formula | C20H19N5O2 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 6-[(3aR,7aS)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]-2-(4-nitrophenyl)-1H-benzimidazole |
| SMILES | O=[N+]([O-])c1ccc(-c2nc3ccc(C4=N[C@@H]5CCCC[C@@H]5N4)cc3[nH]2)cc1 |
| InChI | InChI=1S/C20H19N5O2/c26-25(27)14-8-5-12(6-9-14)19-23-17-10-7-13(11-18(17)24-19)20-21-15-3-1-2-4-16(15)22-20/h5-11,15-16H,1-4H2,(H,21,22)(H,23,24)/t15-,16+ |
| InChIKey | SHHZQPHPVJSYPX-IYBDPMFKSA-N |
| XLogP | 3.80 |
| TPSA | 96.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|