C28H37N5O6S3 — CID 44531704
ethyl N-[2-[(3R)-3-[[(2R,3S)-2-(1-benzothiophen-2-ylmethyl)-3-[formyl(hydroxy)amino]pentanoyl]amino]-2-methyl-4-oxo-4-(1,3-thiazol-2-ylamino)butan-2-yl]sulfanylethyl]carbamate (PubChem CID 44531704) has the molecular formula C28H37N5O6S3 and a molecular weight of 635.83 g/mol. Its IUPAC name is ethyl N-[2-[(3R)-3-[[(2R,3S)-2-(1-benzothiophen-2-ylmethyl)-3-[formyl(hydroxy)amino]pentanoyl]amino]-2-methyl-4-oxo-4-(1,3-thiazol-2-ylamino)butan-2-yl]sulfanylethyl]carbamate.
| Compound Name | ethyl N-[2-[(3R)-3-[[(2R,3S)-2-(1-benzothiophen-2-ylmethyl)-3-[formyl(hydroxy)amino]pentanoyl]amino]-2-methyl-4-oxo-4-(1,3-thiazol-2-ylamino)butan-2-yl]sulfanylethyl]carbamate |
|---|---|
| PubChem CID | 44531704 |
| Molecular Formula | C28H37N5O6S3 |
| Molecular Weight | 635.83 g/mol |
| Exact Mass | 635.19 |
| IUPAC Name | ethyl N-[2-[(3R)-3-[[(2R,3S)-2-(1-benzothiophen-2-ylmethyl)-3-[formyl(hydroxy)amino]pentanoyl]amino]-2-methyl-4-oxo-4-(1,3-thiazol-2-ylamino)butan-2-yl]sulfanylethyl]carbamate |
| SMILES | CCOC(=O)NCCSC(C)(C)[C@H](NC(=O)[C@H](Cc1cc2ccccc2s1)[C@H](CC)N(O)C=O)C(=O)Nc1nccs1 |
| InChI | InChI=1S/C28H37N5O6S3/c1-5-21(33(38)17-34)20(16-19-15-18-9-7-8-10-22(18)42-19)24(35)31-23(25(36)32-26-29-11-13-40-26)28(3,4)41-14-12-30-27(37)39-6-2/h7-11,13,15,17,20-21,23,38H,5-6,12,14,16H2,1-4H3,(H,30,37)(H,31,35)(H,29,32,36)/t20-,21+,23-/m1/s1 |
| InChIKey | VIPCPQUCMUHIBQ-FUPPJEDESA-N |
| XLogP | 4.52 |
| TPSA | 149.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.83 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|