C27H34Cl2N4O3 — CID 44533519
(E)-3-(3,4-dichlorophenyl)-N-[5-[4-[(3-methoxyphenyl)carbamoylamino]piperidin-1-yl]pentyl]prop-2-enamide (PubChem CID 44533519) has the molecular formula C27H34Cl2N4O3 and a molecular weight of 533.50 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-[5-[4-[(3-methoxyphenyl)carbamoylamino]piperidin-1-yl]pentyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-[5-[4-[(3-methoxyphenyl)carbamoylamino]piperidin-1-yl]pentyl]prop-2-enamide |
|---|---|
| PubChem CID | 44533519 |
| Molecular Formula | C27H34Cl2N4O3 |
| Molecular Weight | 533.50 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-[5-[4-[(3-methoxyphenyl)carbamoylamino]piperidin-1-yl]pentyl]prop-2-enamide |
| SMILES | COc1cccc(NC(=O)NC2CCN(CCCCCNC(=O)/C=C/c3ccc(Cl)c(Cl)c3)CC2)c1 |
| InChI | InChI=1S/C27H34Cl2N4O3/c1-36-23-7-5-6-22(19-23)32-27(35)31-21-12-16-33(17-13-21)15-4-2-3-14-30-26(34)11-9-20-8-10-24(28)25(29)18-20/h5-11,18-19,21H,2-4,12-17H2,1H3,(H,30,34)(H2,31,32,35)/b11-9+ |
| InChIKey | CUMDJBLLBKVYBR-PKNBQFBNSA-N |
| XLogP | 5.59 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.50 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|