C28H36BrCl2N3O3S — CID 44533731
N-[5-[3-[3-[(4-bromophenyl)sulfonylamino]propyl]piperidin-1-yl]pentyl]-3-(3,4-dichlorophenyl)prop-2-enamide (PubChem CID 44533731) has the molecular formula C28H36BrCl2N3O3S and a molecular weight of 645.49 g/mol. Its IUPAC name is N-[5-[3-[3-[(4-bromophenyl)sulfonylamino]propyl]piperidin-1-yl]pentyl]-3-(3,4-dichlorophenyl)prop-2-enamide.
| Compound Name | N-[5-[3-[3-[(4-bromophenyl)sulfonylamino]propyl]piperidin-1-yl]pentyl]-3-(3,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 44533731 |
| Molecular Formula | C28H36BrCl2N3O3S |
| Molecular Weight | 645.49 g/mol |
| Exact Mass | 643.10 |
| IUPAC Name | N-[5-[3-[3-[(4-bromophenyl)sulfonylamino]propyl]piperidin-1-yl]pentyl]-3-(3,4-dichlorophenyl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Cl)c(Cl)c1)NCCCCCN1CCCC(CCCNS(=O)(=O)c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C28H36BrCl2N3O3S/c29-24-10-12-25(13-11-24)38(36,37)33-17-4-6-23-7-5-19-34(21-23)18-3-1-2-16-32-28(35)15-9-22-8-14-26(30)27(31)20-22/h8-15,20,23,33H,1-7,16-19,21H2,(H,32,35) |
| InChIKey | JTWIYPFIIKKSIS-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.49 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|