C22H21N3S2 — CID 44541800
(3S,3aR,7E)-5-methyl-2-phenyl-3-thiophen-2-yl-7-(thiophen-2-ylmethylidene)-3,3a,4,6-tetrahydropyrazolo[4,3-c]pyridine (PubChem CID 44541800) has the molecular formula C22H21N3S2 and a molecular weight of 391.57 g/mol. Its IUPAC name is (3S,3aR,7E)-5-methyl-2-phenyl-3-thiophen-2-yl-7-(thiophen-2-ylmethylidene)-3,3a,4,6-tetrahydropyrazolo[4,3-c]pyridine.
| Compound Name | (3S,3aR,7E)-5-methyl-2-phenyl-3-thiophen-2-yl-7-(thiophen-2-ylmethylidene)-3,3a,4,6-tetrahydropyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 44541800 |
| Molecular Formula | C22H21N3S2 |
| Molecular Weight | 391.57 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | (3S,3aR,7E)-5-methyl-2-phenyl-3-thiophen-2-yl-7-(thiophen-2-ylmethylidene)-3,3a,4,6-tetrahydropyrazolo[4,3-c]pyridine |
| SMILES | CN1C/C(=C\c2cccs2)C2=NN(c3ccccc3)[C@H](c3cccs3)[C@H]2C1 |
| InChI | InChI=1S/C22H21N3S2/c1-24-14-16(13-18-9-5-11-26-18)21-19(15-24)22(20-10-6-12-27-20)25(23-21)17-7-3-2-4-8-17/h2-13,19,22H,14-15H2,1H3/b16-13+/t19-,22-/m0/s1 |
| InChIKey | CXSQILIHTWRLFQ-HVFAUHFSSA-N |
| XLogP | 5.37 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.57 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |