C35H27N4OPS — CID 44542607
2-(4-methylanilino)-3-[(triphenyl-λ5-phosphanylidene)amino]-[1]benzothiolo[3,2-d]pyrimidin-4-one (PubChem CID 44542607) has the molecular formula C35H27N4OPS and a molecular weight of 582.67 g/mol. Its IUPAC name is 2-(4-methylanilino)-3-[(triphenyl-λ5-phosphanylidene)amino]-[1]benzothiolo[3,2-d]pyrimidin-4-one.
| Compound Name | 2-(4-methylanilino)-3-[(triphenyl-λ5-phosphanylidene)amino]-[1]benzothiolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 44542607 |
| Molecular Formula | C35H27N4OPS |
| Molecular Weight | 582.67 g/mol |
| Exact Mass | 582.16 |
| IUPAC Name | 2-(4-methylanilino)-3-[(triphenyl-λ5-phosphanylidene)amino]-[1]benzothiolo[3,2-d]pyrimidin-4-one |
| SMILES | Cc1ccc(Nc2nc3c(sc4ccccc43)c(=O)n2N=P(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C35H27N4OPS/c1-25-21-23-26(24-22-25)36-35-37-32-30-19-11-12-20-31(30)42-33(32)34(40)39(35)38-41(27-13-5-2-6-14-27,28-15-7-3-8-16-28)29-17-9-4-10-18-29/h2-24H,1H3,(H,36,37) |
| InChIKey | FXUOZWXSSJUZIK-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.67 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|