C15H18O6 — CID 44550084
dimethyl (4E)-3-methylidene-4-(1-prop-2-enoyloxyethylidene)cyclopentane-1,1-dicarboxylate (PubChem CID 44550084) has the molecular formula C15H18O6 and a molecular weight of 294.30 g/mol. Its IUPAC name is dimethyl (4E)-3-methylidene-4-(1-prop-2-enoyloxyethylidene)cyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl (4E)-3-methylidene-4-(1-prop-2-enoyloxyethylidene)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 44550084 |
| Molecular Formula | C15H18O6 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | dimethyl (4E)-3-methylidene-4-(1-prop-2-enoyloxyethylidene)cyclopentane-1,1-dicarboxylate |
| SMILES | C=CC(=O)O/C(C)=C1\CC(C(=O)OC)(C(=O)OC)CC1=C |
| InChI | InChI=1S/C15H18O6/c1-6-12(16)21-10(3)11-8-15(7-9(11)2,13(17)19-4)14(18)20-5/h6H,1-2,7-8H2,3-5H3/b11-10+ |
| InChIKey | GUFBYIMHPGAHTE-ZHACJKMWSA-N |
| XLogP | 1.67 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|