About (5S)-1,10-dioxaspiro[4.5]dec-2-ene
(5S)-1,10-dioxaspiro[4.5]dec-2-ene (PubChem CID 44551304) has the molecular formula C8H12O2
and a molecular weight of 140.18 g/mol. Its IUPAC name is (5S)-1,10-dioxaspiro[4.5]dec-2-ene.
Molecular Properties
| Compound Name | (5S)-1,10-dioxaspiro[4.5]dec-2-ene |
| PubChem CID | 44551304 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | (5S)-1,10-dioxaspiro[4.5]dec-2-ene |
| SMILES | C1=CO[C@]2(C1)CCCCO2 |
| InChI | InChI=1S/C8H12O2/c1-2-6-9-8(4-1)5-3-7-10-8/h3,7H,1-2,4-6H2/t8-/m0/s1 |
| InChIKey | POKGHAIWORXEJH-QMMMGPOBSA-N |
| XLogP | 1.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5S)-1,10-dioxaspiro[4.5]dec-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-1,10-dioxaspiro[4.5]dec-2-ene?
The IUPAC name of (5S)-1,10-dioxaspiro[4.5]dec-2-ene (CID 44551304) is (5S)-1,10-dioxaspiro[4.5]dec-2-ene.
What is the SMILES notation for (5S)-1,10-dioxaspiro[4.5]dec-2-ene?
The canonical SMILES for (5S)-1,10-dioxaspiro[4.5]dec-2-ene is C1=CO[C@]2(C1)CCCCO2.
What is the InChIKey of (5S)-1,10-dioxaspiro[4.5]dec-2-ene?
The InChIKey is POKGHAIWORXEJH-QMMMGPOBSA-N. The full InChI is InChI=1S/C8H12O2/c1-2-6-9-8(4-1)5-3-7-10-8/h3,7H,1-2,4-6H2/t8-/m0/s1.
What are the key properties of (5S)-1,10-dioxaspiro[4.5]dec-2-ene?
(5S)-1,10-dioxaspiro[4.5]dec-2-ene has a molecular weight of 140.18 g/mol, XLogP of 1.82, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-1,10-dioxaspiro[4.5]dec-2-ene is sourced from PubChem (CID 44551304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).