C19H20N2O7 — CID 44551860
(2S)-2-[[(2S)-2-phenyl-2-(phenylmethoxycarbonylaminooxy)acetyl]amino]oxypropanoic acid (PubChem CID 44551860) has the molecular formula C19H20N2O7 and a molecular weight of 388.38 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-phenyl-2-(phenylmethoxycarbonylaminooxy)acetyl]amino]oxypropanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-phenyl-2-(phenylmethoxycarbonylaminooxy)acetyl]amino]oxypropanoic acid |
|---|---|
| PubChem CID | 44551860 |
| Molecular Formula | C19H20N2O7 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | (2S)-2-[[(2S)-2-phenyl-2-(phenylmethoxycarbonylaminooxy)acetyl]amino]oxypropanoic acid |
| SMILES | C[C@H](ONC(=O)[C@@H](ONC(=O)OCc1ccccc1)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C19H20N2O7/c1-13(18(23)24)27-20-17(22)16(15-10-6-3-7-11-15)28-21-19(25)26-12-14-8-4-2-5-9-14/h2-11,13,16H,12H2,1H3,(H,20,22)(H,21,25)(H,23,24)/t13-,16-/m0/s1 |
| InChIKey | OZJZZONRMJWBGA-BBRMVZONSA-N |
| XLogP | 2.11 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|