C23H39NO4Si — CID 44556523
[(2S,3R)-3-[benzyl-[tert-butyl(dimethyl)silyl]oxyamino]-4-ethoxy-6,6-dimethyl-2,3-dihydropyran-2-yl]methanol (PubChem CID 44556523) has the molecular formula C23H39NO4Si and a molecular weight of 421.65 g/mol. Its IUPAC name is [(2S,3R)-3-[benzyl-[tert-butyl(dimethyl)silyl]oxyamino]-4-ethoxy-6,6-dimethyl-2,3-dihydropyran-2-yl]methanol.
| Compound Name | [(2S,3R)-3-[benzyl-[tert-butyl(dimethyl)silyl]oxyamino]-4-ethoxy-6,6-dimethyl-2,3-dihydropyran-2-yl]methanol |
|---|---|
| PubChem CID | 44556523 |
| Molecular Formula | C23H39NO4Si |
| Molecular Weight | 421.65 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | [(2S,3R)-3-[benzyl-[tert-butyl(dimethyl)silyl]oxyamino]-4-ethoxy-6,6-dimethyl-2,3-dihydropyran-2-yl]methanol |
| SMILES | CCOC1=CC(C)(C)O[C@H](CO)[C@H]1N(Cc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H39NO4Si/c1-9-26-19-15-23(5,6)27-20(17-25)21(19)24(16-18-13-11-10-12-14-18)28-29(7,8)22(2,3)4/h10-15,20-21,25H,9,16-17H2,1-8H3/t20-,21+/m1/s1 |
| InChIKey | VNHPFVYOJFMEHR-RTWAWAEBSA-N |
| XLogP | 4.88 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.65 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|