C18H29NO4Si — CID 74404154
1-[2-benzyl-4-(2-trimethylsilylethoxy)-3,6-dihydrooxazin-3-yl]ethane-1,2-diol (PubChem CID 74404154) has the molecular formula C18H29NO4Si and a molecular weight of 351.52 g/mol. Its IUPAC name is 1-[2-benzyl-4-(2-trimethylsilylethoxy)-3,6-dihydrooxazin-3-yl]ethane-1,2-diol.
| Compound Name | 1-[2-benzyl-4-(2-trimethylsilylethoxy)-3,6-dihydrooxazin-3-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 74404154 |
| Molecular Formula | C18H29NO4Si |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 1-[2-benzyl-4-(2-trimethylsilylethoxy)-3,6-dihydrooxazin-3-yl]ethane-1,2-diol |
| SMILES | C[Si](C)(C)CCOC1=CCON(Cc2ccccc2)C1C(O)CO |
| InChI | InChI=1S/C18H29NO4Si/c1-24(2,3)12-11-22-17-9-10-23-19(18(17)16(21)14-20)13-15-7-5-4-6-8-15/h4-9,16,18,20-21H,10-14H2,1-3H3 |
| InChIKey | XSFACJLKLSBPLG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|