C33H40Br2OS5 — CID 44557250
4,6-bis[(E)-2-(5-bromo-4-octylthiophen-2-yl)ethenyl]thieno[3,4-d][1,3]dithiol-2-one (PubChem CID 44557250) has the molecular formula C33H40Br2OS5 and a molecular weight of 772.83 g/mol. Its IUPAC name is 4,6-bis[(E)-2-(5-bromo-4-octylthiophen-2-yl)ethenyl]thieno[3,4-d][1,3]dithiol-2-one.
| Compound Name | 4,6-bis[(E)-2-(5-bromo-4-octylthiophen-2-yl)ethenyl]thieno[3,4-d][1,3]dithiol-2-one |
|---|---|
| PubChem CID | 44557250 |
| Molecular Formula | C33H40Br2OS5 |
| Molecular Weight | 772.83 g/mol |
| Exact Mass | 770.00 |
| IUPAC Name | 4,6-bis[(E)-2-(5-bromo-4-octylthiophen-2-yl)ethenyl]thieno[3,4-d][1,3]dithiol-2-one |
| SMILES | CCCCCCCCc1cc(/C=C/c2sc(/C=C/c3cc(CCCCCCCC)c(Br)s3)c3sc(=O)sc23)sc1Br |
| InChI | InChI=1S/C33H40Br2OS5/c1-3-5-7-9-11-13-15-23-21-25(37-31(23)34)17-19-27-29-30(41-33(36)40-29)28(39-27)20-18-26-22-24(32(35)38-26)16-14-12-10-8-6-4-2/h17-22H,3-16H2,1-2H3/b19-17+,20-18+ |
| InChIKey | VZLQJNLBMRBICJ-XPWSMXQVSA-N |
| XLogP | 14.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.83 |
| LogP ≤ 5 | 14.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|