C5H10ClN5O — CID 44558609
2-amino-1,4,5,7,8,9-hexahydropurin-6-one;hydron;chloride (PubChem CID 44558609) has the molecular formula C5H10ClN5O and a molecular weight of 191.62 g/mol. Its IUPAC name is 2-amino-1,4,5,7,8,9-hexahydropurin-6-one;hydron;chloride.
| Compound Name | 2-amino-1,4,5,7,8,9-hexahydropurin-6-one;hydron;chloride |
|---|---|
| PubChem CID | 44558609 |
| Molecular Formula | C5H10ClN5O |
| Molecular Weight | 191.62 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 2-amino-1,4,5,7,8,9-hexahydropurin-6-one;hydron;chloride |
| SMILES | NC1=NC2NCNC2C(=O)N1.[Cl-].[H+] |
| InChI | InChI=1S/C5H9N5O.ClH/c6-5-9-3-2(4(11)10-5)7-1-8-3;/h2-3,7-8H,1H2,(H3,6,9,10,11);1H |
| InChIKey | ZMDKRUZEEACMTB-UHFFFAOYSA-N |
| XLogP | -5.61 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.62 |
| LogP ≤ 5 | -5.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |