C20H26O4 — CID 44559796
(4bR)-1,8a-dihydroxy-4b,8,8-trimethyl-2-propan-2-yl-6,7-dihydro-5H-phenanthrene-3,4-dione (PubChem CID 44559796) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is (4bR)-1,8a-dihydroxy-4b,8,8-trimethyl-2-propan-2-yl-6,7-dihydro-5H-phenanthrene-3,4-dione.
| Compound Name | (4bR)-1,8a-dihydroxy-4b,8,8-trimethyl-2-propan-2-yl-6,7-dihydro-5H-phenanthrene-3,4-dione |
|---|---|
| PubChem CID | 44559796 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | (4bR)-1,8a-dihydroxy-4b,8,8-trimethyl-2-propan-2-yl-6,7-dihydro-5H-phenanthrene-3,4-dione |
| SMILES | CC(C)C1=C(O)C2=C(C(=O)C1=O)[C@@]1(C)CCCC(C)(C)C1(O)C=C2 |
| InChI | InChI=1S/C20H26O4/c1-11(2)13-15(21)12-7-10-20(24)18(3,4)8-6-9-19(20,5)14(12)17(23)16(13)22/h7,10-11,21,24H,6,8-9H2,1-5H3/t19-,20?/m1/s1 |
| InChIKey | UNLXJPFNWQDCFZ-FIWHBWSRSA-N |
| XLogP | 3.42 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|