C25H32Br2F2N6O2 — CID 44560540
[2-(2,4-difluorophenyl)-1,3-bis(1,2,4-triazol-1-yl)propan-2-yl] 2,12-dibromododecanoate (PubChem CID 44560540) has the molecular formula C25H32Br2F2N6O2 and a molecular weight of 646.38 g/mol. Its IUPAC name is [2-(2,4-difluorophenyl)-1,3-bis(1,2,4-triazol-1-yl)propan-2-yl] 2,12-dibromododecanoate.
| Compound Name | [2-(2,4-difluorophenyl)-1,3-bis(1,2,4-triazol-1-yl)propan-2-yl] 2,12-dibromododecanoate |
|---|---|
| PubChem CID | 44560540 |
| Molecular Formula | C25H32Br2F2N6O2 |
| Molecular Weight | 646.38 g/mol |
| Exact Mass | 644.09 |
| IUPAC Name | [2-(2,4-difluorophenyl)-1,3-bis(1,2,4-triazol-1-yl)propan-2-yl] 2,12-dibromododecanoate |
| SMILES | O=C(OC(Cn1cncn1)(Cn1cncn1)c1ccc(F)cc1F)C(Br)CCCCCCCCCCBr |
| InChI | InChI=1S/C25H32Br2F2N6O2/c26-12-8-6-4-2-1-3-5-7-9-22(27)24(36)37-25(14-34-18-30-16-32-34,15-35-19-31-17-33-35)21-11-10-20(28)13-23(21)29/h10-11,13,16-19,22H,1-9,12,14-15H2 |
| InChIKey | YQNOLMMJKGFILJ-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 87.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.38 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|