C22H20Cl4N2O2S — CID 44563480
(E)-3-(3,4-dichlorophenyl)-N-[2-[2-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]ethylsulfanyl]ethyl]prop-2-enamide (PubChem CID 44563480) has the molecular formula C22H20Cl4N2O2S and a molecular weight of 518.29 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-[2-[2-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]ethylsulfanyl]ethyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-[2-[2-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]ethylsulfanyl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 44563480 |
| Molecular Formula | C22H20Cl4N2O2S |
| Molecular Weight | 518.29 g/mol |
| Exact Mass | 516.00 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-[2-[2-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]ethylsulfanyl]ethyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)NCCSCCNC(=O)/C=C/c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H20Cl4N2O2S/c23-17-5-1-15(13-19(17)25)3-7-21(29)27-9-11-31-12-10-28-22(30)8-4-16-2-6-18(24)20(26)14-16/h1-8,13-14H,9-12H2,(H,27,29)(H,28,30)/b7-3+,8-4+ |
| InChIKey | ZTQGUZMRJMYXNB-FCXRPNKRSA-N |
| XLogP | 5.99 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.29 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|