C26H28N2O5 — CID 44570519
(E)-3-[3,5-bis[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1H-pyrazol-4-yl]prop-2-en-1-ol (PubChem CID 44570519) has the molecular formula C26H28N2O5 and a molecular weight of 448.52 g/mol. Its IUPAC name is (E)-3-[3,5-bis[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1H-pyrazol-4-yl]prop-2-en-1-ol.
| Compound Name | (E)-3-[3,5-bis[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1H-pyrazol-4-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 44570519 |
| Molecular Formula | C26H28N2O5 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | (E)-3-[3,5-bis[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1H-pyrazol-4-yl]prop-2-en-1-ol |
| SMILES | COc1ccc(/C=C/c2n[nH]c(/C=C/c3ccc(OC)c(OC)c3)c2/C=C/CO)cc1OC |
| InChI | InChI=1S/C26H28N2O5/c1-30-23-13-9-18(16-25(23)32-3)7-11-21-20(6-5-15-29)22(28-27-21)12-8-19-10-14-24(31-2)26(17-19)33-4/h5-14,16-17,29H,15H2,1-4H3,(H,27,28)/b6-5+,11-7+,12-8+ |
| InChIKey | PUSGBYSKLFHPHL-SZKUKKIJSA-N |
| XLogP | 4.79 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |