C24H22N2O4 — CID 136641847
4-[3-[2-(3,4-dimethoxyphenyl)ethenyl]-1H-indazol-6-yl]-2-methoxyphenol (PubChem CID 136641847) has the molecular formula C24H22N2O4 and a molecular weight of 402.45 g/mol. Its IUPAC name is 4-[3-[2-(3,4-dimethoxyphenyl)ethenyl]-1H-indazol-6-yl]-2-methoxyphenol.
| Compound Name | 4-[3-[2-(3,4-dimethoxyphenyl)ethenyl]-1H-indazol-6-yl]-2-methoxyphenol |
|---|---|
| PubChem CID | 136641847 |
| Molecular Formula | C24H22N2O4 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 4-[3-[2-(3,4-dimethoxyphenyl)ethenyl]-1H-indazol-6-yl]-2-methoxyphenol |
| SMILES | COc1cc(-c2ccc3c(C=Cc4ccc(OC)c(OC)c4)n[nH]c3c2)ccc1O |
| InChI | InChI=1S/C24H22N2O4/c1-28-22-11-5-15(12-24(22)30-3)4-9-19-18-8-6-16(13-20(18)26-25-19)17-7-10-21(27)23(14-17)29-2/h4-14,27H,1-3H3,(H,25,26) |
| InChIKey | XTZUWEGTTUIMBG-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 76.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |