C16H17N5O4S — CID 44572794
2-[(E)-[2-(2,5-dimethoxyphenyl)sulfanyl-5-nitrophenyl]methylideneamino]guanidine (PubChem CID 44572794) has the molecular formula C16H17N5O4S and a molecular weight of 375.41 g/mol. Its IUPAC name is 2-[(E)-[2-(2,5-dimethoxyphenyl)sulfanyl-5-nitrophenyl]methylideneamino]guanidine.
| Compound Name | 2-[(E)-[2-(2,5-dimethoxyphenyl)sulfanyl-5-nitrophenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 44572794 |
| Molecular Formula | C16H17N5O4S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 2-[(E)-[2-(2,5-dimethoxyphenyl)sulfanyl-5-nitrophenyl]methylideneamino]guanidine |
| SMILES | COc1ccc(OC)c(Sc2ccc([N+](=O)[O-])cc2/C=N/N=C(N)N)c1 |
| InChI | InChI=1S/C16H17N5O4S/c1-24-12-4-5-13(25-2)15(8-12)26-14-6-3-11(21(22)23)7-10(14)9-19-20-16(17)18/h3-9H,1-2H3,(H4,17,18,20)/b19-9+ |
| InChIKey | CTUPFXOEQQXBPN-DJKKODMXSA-N |
| XLogP | 2.37 |
| TPSA | 138.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|