C16H32ClN7O3 — CID 44577027
2-[4-[6-[2-(dimethylamino)ethoxy]-2-(2-methoxyethylamino)pyrimidin-4-yl]oxybutyl]guanidine;hydrochloride (PubChem CID 44577027) has the molecular formula C16H32ClN7O3 and a molecular weight of 405.93 g/mol. Its IUPAC name is 2-[4-[6-[2-(dimethylamino)ethoxy]-2-(2-methoxyethylamino)pyrimidin-4-yl]oxybutyl]guanidine;hydrochloride.
| Compound Name | 2-[4-[6-[2-(dimethylamino)ethoxy]-2-(2-methoxyethylamino)pyrimidin-4-yl]oxybutyl]guanidine;hydrochloride |
|---|---|
| PubChem CID | 44577027 |
| Molecular Formula | C16H32ClN7O3 |
| Molecular Weight | 405.93 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 2-[4-[6-[2-(dimethylamino)ethoxy]-2-(2-methoxyethylamino)pyrimidin-4-yl]oxybutyl]guanidine;hydrochloride |
| SMILES | COCCNc1nc(OCCCCN=C(N)N)cc(OCCN(C)C)n1.Cl |
| InChI | InChI=1S/C16H31N7O3.ClH/c1-23(2)8-11-26-14-12-13(21-16(22-14)20-7-10-24-3)25-9-5-4-6-19-15(17)18;/h12H,4-11H2,1-3H3,(H4,17,18,19)(H,20,21,22);1H |
| InChIKey | XYXKUCJKDKFVBE-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 133.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.93 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|