C24H30INO5 — CID 44578510
[3-[4-(3,4-dimethyl-2-oxochromen-7-yl)oxybutoxy]-5-hydroxyphenyl]-trimethylazanium iodide (PubChem CID 44578510) has the molecular formula C24H30INO5 and a molecular weight of 539.41 g/mol. Its IUPAC name is [3-[4-(3,4-dimethyl-2-oxochromen-7-yl)oxybutoxy]-5-hydroxyphenyl]-trimethylazanium iodide.
| Compound Name | [3-[4-(3,4-dimethyl-2-oxochromen-7-yl)oxybutoxy]-5-hydroxyphenyl]-trimethylazanium iodide |
|---|---|
| PubChem CID | 44578510 |
| Molecular Formula | C24H30INO5 |
| Molecular Weight | 539.41 g/mol |
| Exact Mass | 539.12 |
| IUPAC Name | [3-[4-(3,4-dimethyl-2-oxochromen-7-yl)oxybutoxy]-5-hydroxyphenyl]-trimethylazanium iodide |
| SMILES | Cc1c(C)c2ccc(OCCCCOc3cc(O)cc([N+](C)(C)C)c3)cc2oc1=O.[I-] |
| InChI | InChI=1S/C24H29NO5.HI/c1-16-17(2)24(27)30-23-15-20(8-9-22(16)23)28-10-6-7-11-29-21-13-18(25(3,4)5)12-19(26)14-21;/h8-9,12-15H,6-7,10-11H2,1-5H3;1H |
| InChIKey | WVUYESXWTDNQAA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.41 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|