C24H29NO7 — CID 57396496
3-[4-[3-(dimethylamino)-5-hydroxyphenoxy]butoxy]-6,7-dimethoxy-4-methylchromen-2-one (PubChem CID 57396496) has the molecular formula C24H29NO7 and a molecular weight of 443.50 g/mol. Its IUPAC name is 3-[4-[3-(dimethylamino)-5-hydroxyphenoxy]butoxy]-6,7-dimethoxy-4-methylchromen-2-one.
| Compound Name | 3-[4-[3-(dimethylamino)-5-hydroxyphenoxy]butoxy]-6,7-dimethoxy-4-methylchromen-2-one |
|---|---|
| PubChem CID | 57396496 |
| Molecular Formula | C24H29NO7 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 3-[4-[3-(dimethylamino)-5-hydroxyphenoxy]butoxy]-6,7-dimethoxy-4-methylchromen-2-one |
| SMILES | COc1cc2oc(=O)c(OCCCCOc3cc(O)cc(N(C)C)c3)c(C)c2cc1OC |
| InChI | InChI=1S/C24H29NO7/c1-15-19-13-21(28-4)22(29-5)14-20(19)32-24(27)23(15)31-9-7-6-8-30-18-11-16(25(2)3)10-17(26)12-18/h10-14,26H,6-9H2,1-5H3 |
| InChIKey | INGQQCBCWQDABA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 90.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|