C29H31N2S2+ — CID 44584893
3-ethyl-2-[(E)-2-[(E)-(3-ethyl-5,6-dimethyl-1,3-benzothiazol-2-ylidene)methyl]but-1-enyl]benzo[g][1,3]benzothiazol-3-ium (PubChem CID 44584893) has the molecular formula C29H31N2S2+ and a molecular weight of 471.72 g/mol. Its IUPAC name is 3-ethyl-2-[(E)-2-[(E)-(3-ethyl-5,6-dimethyl-1,3-benzothiazol-2-ylidene)methyl]but-1-enyl]benzo[g][1,3]benzothiazol-3-ium.
| Compound Name | 3-ethyl-2-[(E)-2-[(E)-(3-ethyl-5,6-dimethyl-1,3-benzothiazol-2-ylidene)methyl]but-1-enyl]benzo[g][1,3]benzothiazol-3-ium |
|---|---|
| PubChem CID | 44584893 |
| Molecular Formula | C29H31N2S2+ |
| Molecular Weight | 471.72 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 3-ethyl-2-[(E)-2-[(E)-(3-ethyl-5,6-dimethyl-1,3-benzothiazol-2-ylidene)methyl]but-1-enyl]benzo[g][1,3]benzothiazol-3-ium |
| SMILES | CCC(=C\c1sc2c3ccccc3ccc2[n+]1CC)/C=C1/Sc2cc(C)c(C)cc2N1CC |
| InChI | InChI=1S/C29H31N2S2/c1-6-21(17-27-31(8-3)25-15-19(4)20(5)16-26(25)32-27)18-28-30(7-2)24-14-13-22-11-9-10-12-23(22)29(24)33-28/h9-18H,6-8H2,1-5H3/q+1 |
| InChIKey | ILOBGOMQHCDPQT-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.72 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|