C33H38N4O6S — CID 44588304
(4R)-3-[(2S,3S)-3-[[2-(3-aminophenoxy)acetyl]amino]-2-hydroxy-4-phenylbutanoyl]-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-5,5-dimethyl-1,3-thiazolidine-4-carboxamide (PubChem CID 44588304) has the molecular formula C33H38N4O6S and a molecular weight of 618.76 g/mol. Its IUPAC name is (4R)-3-[(2S,3S)-3-[[2-(3-aminophenoxy)acetyl]amino]-2-hydroxy-4-phenylbutanoyl]-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-5,5-dimethyl-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4R)-3-[(2S,3S)-3-[[2-(3-aminophenoxy)acetyl]amino]-2-hydroxy-4-phenylbutanoyl]-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-5,5-dimethyl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 44588304 |
| Molecular Formula | C33H38N4O6S |
| Molecular Weight | 618.76 g/mol |
| Exact Mass | 618.25 |
| IUPAC Name | (4R)-3-[(2S,3S)-3-[[2-(3-aminophenoxy)acetyl]amino]-2-hydroxy-4-phenylbutanoyl]-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-5,5-dimethyl-1,3-thiazolidine-4-carboxamide |
| SMILES | CC1(C)SCN(C(=O)[C@@H](O)[C@H](Cc2ccccc2)NC(=O)COc2cccc(N)c2)[C@@H]1C(=O)N[C@H]1c2ccccc2C[C@H]1O |
| InChI | InChI=1S/C33H38N4O6S/c1-33(2)30(31(41)36-28-24-14-7-6-11-21(24)16-26(28)38)37(19-44-33)32(42)29(40)25(15-20-9-4-3-5-10-20)35-27(39)18-43-23-13-8-12-22(34)17-23/h3-14,17,25-26,28-30,38,40H,15-16,18-19,34H2,1-2H3,(H,35,39)(H,36,41)/t25-,26+,28-,29-,30+/m0/s1 |
| InChIKey | LQEMUNLLUUKMPD-DOWNBTJOSA-N |
| XLogP | 2.19 |
| TPSA | 154.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.76 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|