C19H28N2O2 — CID 44589110
(1S,2S,5R)-2-methoxy-8-[(4-methoxyphenyl)methyl]-6-prop-2-enyl-6,8-diazabicyclo[3.2.2]nonane (PubChem CID 44589110) has the molecular formula C19H28N2O2 and a molecular weight of 316.45 g/mol. Its IUPAC name is (1S,2S,5R)-2-methoxy-8-[(4-methoxyphenyl)methyl]-6-prop-2-enyl-6,8-diazabicyclo[3.2.2]nonane.
| Compound Name | (1S,2S,5R)-2-methoxy-8-[(4-methoxyphenyl)methyl]-6-prop-2-enyl-6,8-diazabicyclo[3.2.2]nonane |
|---|---|
| PubChem CID | 44589110 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | (1S,2S,5R)-2-methoxy-8-[(4-methoxyphenyl)methyl]-6-prop-2-enyl-6,8-diazabicyclo[3.2.2]nonane |
| SMILES | C=CCN1C[C@H]2[C@@H](OC)CC[C@@H]1CN2Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C19H28N2O2/c1-4-11-20-14-18-19(23-3)10-7-16(20)13-21(18)12-15-5-8-17(22-2)9-6-15/h4-6,8-9,16,18-19H,1,7,10-14H2,2-3H3/t16-,18+,19+/m1/s1 |
| InChIKey | OVOUDWSXPLANNM-NEWSRXKRSA-N |
| XLogP | 2.54 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|