C25H26N4O2S — CID 44590151
N-(2-amino-5-thiophen-2-ylphenyl)-6-(4-oxo-8-azaspiro[4.5]decan-8-yl)pyridine-3-carboxamide (PubChem CID 44590151) has the molecular formula C25H26N4O2S and a molecular weight of 446.58 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)-6-(4-oxo-8-azaspiro[4.5]decan-8-yl)pyridine-3-carboxamide.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)-6-(4-oxo-8-azaspiro[4.5]decan-8-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 44590151 |
| Molecular Formula | C25H26N4O2S |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)-6-(4-oxo-8-azaspiro[4.5]decan-8-yl)pyridine-3-carboxamide |
| SMILES | Nc1ccc(-c2cccs2)cc1NC(=O)c1ccc(N2CCC3(CCCC3=O)CC2)nc1 |
| InChI | InChI=1S/C25H26N4O2S/c26-19-7-5-17(21-3-2-14-32-21)15-20(19)28-24(31)18-6-8-23(27-16-18)29-12-10-25(11-13-29)9-1-4-22(25)30/h2-3,5-8,14-16H,1,4,9-13,26H2,(H,28,31) |
| InChIKey | FWKBFPQWMNWVEP-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|