C33H49NO4 — CID 44597831
10-[[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy]-2,9-dimethyl-10-oxodecanoic acid (PubChem CID 44597831) has the molecular formula C33H49NO4 and a molecular weight of 523.76 g/mol. Its IUPAC name is 10-[[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy]-2,9-dimethyl-10-oxodecanoic acid.
| Compound Name | 10-[[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy]-2,9-dimethyl-10-oxodecanoic acid |
|---|---|
| PubChem CID | 44597831 |
| Molecular Formula | C33H49NO4 |
| Molecular Weight | 523.76 g/mol |
| Exact Mass | 523.37 |
| IUPAC Name | 10-[[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy]-2,9-dimethyl-10-oxodecanoic acid |
| SMILES | CC(CCCCCCC(C)C(=O)Oc1ccc2c(c1)[C@@]13CCCC[C@H]1[C@@H](C2)N(CC1CCC1)CC3)C(=O)O |
| InChI | InChI=1S/C33H49NO4/c1-23(31(35)36)10-5-3-4-6-11-24(2)32(37)38-27-16-15-26-20-30-28-14-7-8-17-33(28,29(26)21-27)18-19-34(30)22-25-12-9-13-25/h15-16,21,23-25,28,30H,3-14,17-20,22H2,1-2H3,(H,35,36)/t23?,24?,28-,30+,33+/m0/s1 |
| InChIKey | COZHNMYHYJDWAU-FPZANPRSSA-N |
| XLogP | 7.15 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.76 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|