C32H24BrNO4S — CID 44603590
[5-benzoyl-6-(4-bromophenyl)-1-(4-methylphenyl)sulfonyl-2H-pyridin-3-yl]-phenylmethanone (PubChem CID 44603590) has the molecular formula C32H24BrNO4S and a molecular weight of 598.52 g/mol. Its IUPAC name is [5-benzoyl-6-(4-bromophenyl)-1-(4-methylphenyl)sulfonyl-2H-pyridin-3-yl]-phenylmethanone.
| Compound Name | [5-benzoyl-6-(4-bromophenyl)-1-(4-methylphenyl)sulfonyl-2H-pyridin-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 44603590 |
| Molecular Formula | C32H24BrNO4S |
| Molecular Weight | 598.52 g/mol |
| Exact Mass | 597.06 |
| IUPAC Name | [5-benzoyl-6-(4-bromophenyl)-1-(4-methylphenyl)sulfonyl-2H-pyridin-3-yl]-phenylmethanone |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(C(=O)c3ccccc3)=CC(C(=O)c3ccccc3)=C2c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C32H24BrNO4S/c1-22-12-18-28(19-13-22)39(37,38)34-21-26(31(35)24-8-4-2-5-9-24)20-29(32(36)25-10-6-3-7-11-25)30(34)23-14-16-27(33)17-15-23/h2-20H,21H2,1H3 |
| InChIKey | INKQIVCXKHCURL-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.52 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |