C20H24N2O8S — CID 44604160
diethyl 2-(4-methylphenyl)sulfonyl-1,3-dioxo-4,4a,5,7-tetrahydropyrrolo[1,2-c]pyrimidine-6,6-dicarboxylate (PubChem CID 44604160) has the molecular formula C20H24N2O8S and a molecular weight of 452.49 g/mol. Its IUPAC name is diethyl 2-(4-methylphenyl)sulfonyl-1,3-dioxo-4,4a,5,7-tetrahydropyrrolo[1,2-c]pyrimidine-6,6-dicarboxylate.
| Compound Name | diethyl 2-(4-methylphenyl)sulfonyl-1,3-dioxo-4,4a,5,7-tetrahydropyrrolo[1,2-c]pyrimidine-6,6-dicarboxylate |
|---|---|
| PubChem CID | 44604160 |
| Molecular Formula | C20H24N2O8S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | diethyl 2-(4-methylphenyl)sulfonyl-1,3-dioxo-4,4a,5,7-tetrahydropyrrolo[1,2-c]pyrimidine-6,6-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC2CC(=O)N(S(=O)(=O)c3ccc(C)cc3)C(=O)N2C1 |
| InChI | InChI=1S/C20H24N2O8S/c1-4-29-17(24)20(18(25)30-5-2)11-14-10-16(23)22(19(26)21(14)12-20)31(27,28)15-8-6-13(3)7-9-15/h6-9,14H,4-5,10-12H2,1-3H3 |
| InChIKey | MUTOYWMEWYYASD-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|