C23H31NO7S — CID 101221269
diethyl (4Z)-4-but-3-enylidene-2-ethoxy-1-(4-methylphenyl)sulfonylpyrrolidine-3,3-dicarboxylate (PubChem CID 101221269) has the molecular formula C23H31NO7S and a molecular weight of 465.57 g/mol. Its IUPAC name is diethyl (4Z)-4-but-3-enylidene-2-ethoxy-1-(4-methylphenyl)sulfonylpyrrolidine-3,3-dicarboxylate.
| Compound Name | diethyl (4Z)-4-but-3-enylidene-2-ethoxy-1-(4-methylphenyl)sulfonylpyrrolidine-3,3-dicarboxylate |
|---|---|
| PubChem CID | 101221269 |
| Molecular Formula | C23H31NO7S |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | diethyl (4Z)-4-but-3-enylidene-2-ethoxy-1-(4-methylphenyl)sulfonylpyrrolidine-3,3-dicarboxylate |
| SMILES | C=CC/C=C1\CN(S(=O)(=O)c2ccc(C)cc2)C(OCC)C1(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C23H31NO7S/c1-6-10-11-18-16-24(32(27,28)19-14-12-17(5)13-15-19)20(29-7-2)23(18,21(25)30-8-3)22(26)31-9-4/h6,11-15,20H,1,7-10,16H2,2-5H3/b18-11+ |
| InChIKey | BMQJNBYERTZADQ-WOJGMQOQSA-N |
| XLogP | 2.98 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|