C23H38O3 — CID 44606431
(1S,2S,3R,8S,10S,11R,14R,15S)-5,5,14-trimethyl-18-methylidene-11-propan-2-yl-4,6-dioxatetracyclo[8.8.0.02,15.03,8]octadecan-1-ol (PubChem CID 44606431) has the molecular formula C23H38O3 and a molecular weight of 362.55 g/mol. Its IUPAC name is (1S,2S,3R,8S,10S,11R,14R,15S)-5,5,14-trimethyl-18-methylidene-11-propan-2-yl-4,6-dioxatetracyclo[8.8.0.02,15.03,8]octadecan-1-ol.
| Compound Name | (1S,2S,3R,8S,10S,11R,14R,15S)-5,5,14-trimethyl-18-methylidene-11-propan-2-yl-4,6-dioxatetracyclo[8.8.0.02,15.03,8]octadecan-1-ol |
|---|---|
| PubChem CID | 44606431 |
| Molecular Formula | C23H38O3 |
| Molecular Weight | 362.55 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | (1S,2S,3R,8S,10S,11R,14R,15S)-5,5,14-trimethyl-18-methylidene-11-propan-2-yl-4,6-dioxatetracyclo[8.8.0.02,15.03,8]octadecan-1-ol |
| SMILES | C=C1CCC2[C@H](C)CC[C@H](C(C)C)[C@@H]3C[C@H]4COC(C)(C)O[C@H]4[C@H]2[C@]13O |
| InChI | InChI=1S/C23H38O3/c1-13(2)17-9-7-14(3)18-10-8-15(4)23(24)19(17)11-16-12-25-22(5,6)26-21(16)20(18)23/h13-14,16-21,24H,4,7-12H2,1-3,5-6H3/t14-,16+,17-,18?,19+,20+,21-,23+/m1/s1 |
| InChIKey | KMEOTJBXYSZBLD-GBZDWSMLSA-N |
| XLogP | 4.79 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.55 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|