C31H27ClFN4Na2O10PS — CID 44608632
disodium;[[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-yl]methyl-(2,2-dideuterio-2-methylsulfonylethyl)carbamoyl]oxymethyl phosphate (PubChem CID 44608632) has the molecular formula C31H27ClFN4Na2O10PS and a molecular weight of 781.06 g/mol. Its IUPAC name is disodium;[[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-yl]methyl-(2,2-dideuterio-2-methylsulfonylethyl)carbamoyl]oxymethyl phosphate.
| Compound Name | disodium;[[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-yl]methyl-(2,2-dideuterio-2-methylsulfonylethyl)carbamoyl]oxymethyl phosphate |
|---|---|
| PubChem CID | 44608632 |
| Molecular Formula | C31H27ClFN4Na2O10PS |
| Molecular Weight | 781.06 g/mol |
| Exact Mass | 780.08 |
| IUPAC Name | disodium;[[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-yl]methyl-(2,2-dideuterio-2-methylsulfonylethyl)carbamoyl]oxymethyl phosphate |
| SMILES | [2H]C([2H])(CN(Cc1ccc(-c2ccc3ncnc(Nc4ccc(OCc5cccc(F)c5)c(Cl)c4)c3c2)o1)C(=O)OCOP(=O)([O-])[O-])S(C)(=O)=O.[Na+].[Na+] |
| InChI | InChI=1S/C31H29ClFN4O10PS.2Na/c1-49(42,43)12-11-37(31(38)45-19-46-48(39,40)41)16-24-7-10-28(47-24)21-5-8-27-25(14-21)30(35-18-34-27)36-23-6-9-29(26(32)15-23)44-17-20-3-2-4-22(33)13-20;;/h2-10,13-15,18H,11-12,16-17,19H2,1H3,(H,34,35,36)(H2,39,40,41);;/q;2*+1/p-2/i12D2;; |
| InChIKey | FQYJSMGPELRYGK-ZGJYSPQCSA-L |
| XLogP | -1.20 |
| TPSA | 196.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.06 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|