C31H29ClFN4O10PS — CID 44609445
phosphonooxymethyl N-[[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-yl]methyl]-N-(1,1,2,2-tetradeuterio-2-methylsulfonylethyl)carbamate (PubChem CID 44609445) has the molecular formula C31H29ClFN4O10PS and a molecular weight of 739.11 g/mol. Its IUPAC name is phosphonooxymethyl N-[[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-yl]methyl]-N-(1,1,2,2-tetradeuterio-2-methylsulfonylethyl)carbamate.
| Compound Name | phosphonooxymethyl N-[[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-yl]methyl]-N-(1,1,2,2-tetradeuterio-2-methylsulfonylethyl)carbamate |
|---|---|
| PubChem CID | 44609445 |
| Molecular Formula | C31H29ClFN4O10PS |
| Molecular Weight | 739.11 g/mol |
| Exact Mass | 738.13 |
| IUPAC Name | phosphonooxymethyl N-[[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-yl]methyl]-N-(1,1,2,2-tetradeuterio-2-methylsulfonylethyl)carbamate |
| SMILES | [2H]C([2H])(N(Cc1ccc(-c2ccc3ncnc(Nc4ccc(OCc5cccc(F)c5)c(Cl)c4)c3c2)o1)C(=O)OCOP(=O)(O)O)C([2H])([2H])S(C)(=O)=O |
| InChI | InChI=1S/C31H29ClFN4O10PS/c1-49(42,43)12-11-37(31(38)45-19-46-48(39,40)41)16-24-7-10-28(47-24)21-5-8-27-25(14-21)30(35-18-34-27)36-23-6-9-29(26(32)15-23)44-17-20-3-2-4-22(33)13-20/h2-10,13-15,18H,11-12,16-17,19H2,1H3,(H,34,35,36)(H2,39,40,41)/i11D2,12D2 |
| InChIKey | ZMUWTHNYPSIRDI-AREBVXNXSA-N |
| XLogP | 6.05 |
| TPSA | 190.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.11 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|