C21H23ClN4O3S — CID 44608755
N-[2-chloro-5-[4-(2,2-dimethylmorpholin-4-yl)quinolin-6-yl]-3-pyridinyl]methanesulfonamide (PubChem CID 44608755) has the molecular formula C21H23ClN4O3S and a molecular weight of 446.96 g/mol. Its IUPAC name is N-[2-chloro-5-[4-(2,2-dimethylmorpholin-4-yl)quinolin-6-yl]-3-pyridinyl]methanesulfonamide.
| Compound Name | N-[2-chloro-5-[4-(2,2-dimethylmorpholin-4-yl)quinolin-6-yl]-3-pyridinyl]methanesulfonamide |
|---|---|
| PubChem CID | 44608755 |
| Molecular Formula | C21H23ClN4O3S |
| Molecular Weight | 446.96 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | N-[2-chloro-5-[4-(2,2-dimethylmorpholin-4-yl)quinolin-6-yl]-3-pyridinyl]methanesulfonamide |
| SMILES | CC1(C)CN(c2ccnc3ccc(-c4cnc(Cl)c(NS(C)(=O)=O)c4)cc23)CCO1 |
| InChI | InChI=1S/C21H23ClN4O3S/c1-21(2)13-26(8-9-29-21)19-6-7-23-17-5-4-14(10-16(17)19)15-11-18(20(22)24-12-15)25-30(3,27)28/h4-7,10-12,25H,8-9,13H2,1-3H3 |
| InChIKey | ZEYXMGMEPMUWSC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.96 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|