C21H12F4N2O — CID 44609933
3-(2,3-difluorophenyl)-1-[(2,4-difluorophenyl)methyl]cinnolin-4-one (PubChem CID 44609933) has the molecular formula C21H12F4N2O and a molecular weight of 384.33 g/mol. Its IUPAC name is 3-(2,3-difluorophenyl)-1-[(2,4-difluorophenyl)methyl]cinnolin-4-one.
| Compound Name | 3-(2,3-difluorophenyl)-1-[(2,4-difluorophenyl)methyl]cinnolin-4-one |
|---|---|
| PubChem CID | 44609933 |
| Molecular Formula | C21H12F4N2O |
| Molecular Weight | 384.33 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 3-(2,3-difluorophenyl)-1-[(2,4-difluorophenyl)methyl]cinnolin-4-one |
| SMILES | O=c1c(-c2cccc(F)c2F)nn(Cc2ccc(F)cc2F)c2ccccc12 |
| InChI | InChI=1S/C21H12F4N2O/c22-13-9-8-12(17(24)10-13)11-27-18-7-2-1-4-14(18)21(28)20(26-27)15-5-3-6-16(23)19(15)25/h1-10H,11H2 |
| InChIKey | GQFOFQQKCJDOIH-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.33 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |