About 3-(4-chlorophenyl)-1-[(2,4-difluorophenyl)methyl]cinnolin-4-one
3-(4-chlorophenyl)-1-[(2,4-difluorophenyl)methyl]cinnolin-4-one (PubChem CID 44609472) has the molecular formula C21H13ClF2N2O
and a molecular weight of 382.80 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-[(2,4-difluorophenyl)methyl]cinnolin-4-one.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-1-[(2,4-difluorophenyl)methyl]cinnolin-4-one |
| PubChem CID | 44609472 |
| Molecular Formula | C21H13ClF2N2O |
| Molecular Weight | 382.80 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 3-(4-chlorophenyl)-1-[(2,4-difluorophenyl)methyl]cinnolin-4-one |
| SMILES | O=c1c(-c2ccc(Cl)cc2)nn(Cc2ccc(F)cc2F)c2ccccc12 |
| InChI | InChI=1S/C21H13ClF2N2O/c22-15-8-5-13(6-9-15)20-21(27)17-3-1-2-4-19(17)26(25-20)12-14-7-10-16(23)11-18(14)24/h1-11H,12H2 |
| InChIKey | HKOOOFAVCMEBRF-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.80 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-chlorophenyl)-1-[(2,4-difluorophenyl)methyl]cinnolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-1-[(2,4-difluorophenyl)methyl]cinnolin-4-one?
The IUPAC name of 3-(4-chlorophenyl)-1-[(2,4-difluorophenyl)methyl]cinnolin-4-one (CID 44609472) is 3-(4-chlorophenyl)-1-[(2,4-difluorophenyl)methyl]cinnolin-4-one.
What is the SMILES notation for 3-(4-chlorophenyl)-1-[(2,4-difluorophenyl)methyl]cinnolin-4-one?
The canonical SMILES for 3-(4-chlorophenyl)-1-[(2,4-difluorophenyl)methyl]cinnolin-4-one is O=c1c(-c2ccc(Cl)cc2)nn(Cc2ccc(F)cc2F)c2ccccc12.
What is the InChIKey of 3-(4-chlorophenyl)-1-[(2,4-difluorophenyl)methyl]cinnolin-4-one?
The InChIKey is HKOOOFAVCMEBRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H13ClF2N2O/c22-15-8-5-13(6-9-15)20-21(27)17-3-1-2-4-19(17)26(25-20)12-14-7-10-16(23)11-18(14)24/h1-11H,12H2.
What are the key properties of 3-(4-chlorophenyl)-1-[(2,4-difluorophenyl)methyl]cinnolin-4-one?
3-(4-chlorophenyl)-1-[(2,4-difluorophenyl)methyl]cinnolin-4-one has a molecular weight of 382.80 g/mol, XLogP of 5.04, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-1-[(2,4-difluorophenyl)methyl]cinnolin-4-one is sourced from PubChem (CID 44609472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).