C19H14F2N2O2 — CID 90666918
[5-[1-[(2,4-difluorophenyl)methyl]indazol-3-yl]furan-2-yl]methanol (PubChem CID 90666918) has the molecular formula C19H14F2N2O2 and a molecular weight of 340.33 g/mol. Its IUPAC name is [5-[1-[(2,4-difluorophenyl)methyl]indazol-3-yl]furan-2-yl]methanol.
| Compound Name | [5-[1-[(2,4-difluorophenyl)methyl]indazol-3-yl]furan-2-yl]methanol |
|---|---|
| PubChem CID | 90666918 |
| Molecular Formula | C19H14F2N2O2 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | [5-[1-[(2,4-difluorophenyl)methyl]indazol-3-yl]furan-2-yl]methanol |
| SMILES | OCc1ccc(-c2nn(Cc3ccc(F)cc3F)c3ccccc23)o1 |
| InChI | InChI=1S/C19H14F2N2O2/c20-13-6-5-12(16(21)9-13)10-23-17-4-2-1-3-15(17)19(22-23)18-8-7-14(11-24)25-18/h1-9,24H,10-11H2 |
| InChIKey | AUUKIMXJYJBMIS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |