About [5-[1-[(2,4-difluorophenyl)methyl]indazol-3-yl]furan-2-yl]methanol
[5-[1-[(2,4-difluorophenyl)methyl]indazol-3-yl]furan-2-yl]methanol (PubChem CID 90666918) has the molecular formula C19H14F2N2O2
and a molecular weight of 340.33 g/mol. Its IUPAC name is [5-[1-[(2,4-difluorophenyl)methyl]indazol-3-yl]furan-2-yl]methanol.
Molecular Properties
| Compound Name | [5-[1-[(2,4-difluorophenyl)methyl]indazol-3-yl]furan-2-yl]methanol |
| PubChem CID | 90666918 |
| Molecular Formula | C19H14F2N2O2 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | [5-[1-[(2,4-difluorophenyl)methyl]indazol-3-yl]furan-2-yl]methanol |
| SMILES | OCc1ccc(-c2nn(Cc3ccc(F)cc3F)c3ccccc23)o1 |
| InChI | InChI=1S/C19H14F2N2O2/c20-13-6-5-12(16(21)9-13)10-23-17-4-2-1-3-15(17)19(22-23)18-8-7-14(11-24)25-18/h1-9,24H,10-11H2 |
| InChIKey | AUUKIMXJYJBMIS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-[1-[(2,4-difluorophenyl)methyl]indazol-3-yl]furan-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[1-[(2,4-difluorophenyl)methyl]indazol-3-yl]furan-2-yl]methanol?
The IUPAC name of [5-[1-[(2,4-difluorophenyl)methyl]indazol-3-yl]furan-2-yl]methanol (CID 90666918) is [5-[1-[(2,4-difluorophenyl)methyl]indazol-3-yl]furan-2-yl]methanol.
What is the SMILES notation for [5-[1-[(2,4-difluorophenyl)methyl]indazol-3-yl]furan-2-yl]methanol?
The canonical SMILES for [5-[1-[(2,4-difluorophenyl)methyl]indazol-3-yl]furan-2-yl]methanol is OCc1ccc(-c2nn(Cc3ccc(F)cc3F)c3ccccc23)o1.
What is the InChIKey of [5-[1-[(2,4-difluorophenyl)methyl]indazol-3-yl]furan-2-yl]methanol?
The InChIKey is AUUKIMXJYJBMIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14F2N2O2/c20-13-6-5-12(16(21)9-13)10-23-17-4-2-1-3-15(17)19(22-23)18-8-7-14(11-24)25-18/h1-9,24H,10-11H2.
What are the key properties of [5-[1-[(2,4-difluorophenyl)methyl]indazol-3-yl]furan-2-yl]methanol?
[5-[1-[(2,4-difluorophenyl)methyl]indazol-3-yl]furan-2-yl]methanol has a molecular weight of 340.33 g/mol, XLogP of 4.12, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[1-[(2,4-difluorophenyl)methyl]indazol-3-yl]furan-2-yl]methanol is sourced from PubChem (CID 90666918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).