C19H14F2N4 — CID 118875149
2-[1-[(2,4-difluorophenyl)methyl]indazol-3-yl]pyridin-4-amine (PubChem CID 118875149) has the molecular formula C19H14F2N4 and a molecular weight of 336.35 g/mol. Its IUPAC name is 2-[1-[(2,4-difluorophenyl)methyl]indazol-3-yl]pyridin-4-amine.
| Compound Name | 2-[1-[(2,4-difluorophenyl)methyl]indazol-3-yl]pyridin-4-amine |
|---|---|
| PubChem CID | 118875149 |
| Molecular Formula | C19H14F2N4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 2-[1-[(2,4-difluorophenyl)methyl]indazol-3-yl]pyridin-4-amine |
| SMILES | Nc1ccnc(-c2nn(Cc3ccc(F)cc3F)c3ccccc23)c1 |
| InChI | InChI=1S/C19H14F2N4/c20-13-6-5-12(16(21)9-13)11-25-18-4-2-1-3-15(18)19(24-25)17-10-14(22)7-8-23-17/h1-10H,11H2,(H2,22,23) |
| InChIKey | SXOIRZWCZHMQPF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |