C17H15NO4 — CID 44610701
2-[4-(dimethylamino)phenyl]-7,8-dihydroxychromen-4-one (PubChem CID 44610701) has the molecular formula C17H15NO4 and a molecular weight of 297.31 g/mol. Its IUPAC name is 2-[4-(dimethylamino)phenyl]-7,8-dihydroxychromen-4-one.
| Compound Name | 2-[4-(dimethylamino)phenyl]-7,8-dihydroxychromen-4-one |
|---|---|
| PubChem CID | 44610701 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 2-[4-(dimethylamino)phenyl]-7,8-dihydroxychromen-4-one |
| SMILES | CN(C)c1ccc(-c2cc(=O)c3ccc(O)c(O)c3o2)cc1 |
| InChI | InChI=1S/C17H15NO4/c1-18(2)11-5-3-10(4-6-11)15-9-14(20)12-7-8-13(19)16(21)17(12)22-15/h3-9,19,21H,1-2H3 |
| InChIKey | YPAYCZOHGRSGJS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|