C22H18N2OS — CID 44615168
N-[3-(4-methylphenyl)-2H-1,4-benzothiazin-2-yl]benzamide (PubChem CID 44615168) has the molecular formula C22H18N2OS and a molecular weight of 358.47 g/mol. Its IUPAC name is N-[3-(4-methylphenyl)-2H-1,4-benzothiazin-2-yl]benzamide.
| Compound Name | N-[3-(4-methylphenyl)-2H-1,4-benzothiazin-2-yl]benzamide |
|---|---|
| PubChem CID | 44615168 |
| Molecular Formula | C22H18N2OS |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | N-[3-(4-methylphenyl)-2H-1,4-benzothiazin-2-yl]benzamide |
| SMILES | Cc1ccc(C2=Nc3ccccc3SC2NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H18N2OS/c1-15-11-13-16(14-12-15)20-22(24-21(25)17-7-3-2-4-8-17)26-19-10-6-5-9-18(19)23-20/h2-14,22H,1H3,(H,24,25) |
| InChIKey | NKXCPZSHRJMXQL-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |