C36H30N4O3 — CID 44615332
(4Z)-5-(4-methoxyphenyl)-4-[[3-(3-methyl-4-prop-2-enoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-2-phenylpyrazol-3-one (PubChem CID 44615332) has the molecular formula C36H30N4O3 and a molecular weight of 566.66 g/mol. Its IUPAC name is (4Z)-5-(4-methoxyphenyl)-4-[[3-(3-methyl-4-prop-2-enoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-2-phenylpyrazol-3-one.
| Compound Name | (4Z)-5-(4-methoxyphenyl)-4-[[3-(3-methyl-4-prop-2-enoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 44615332 |
| Molecular Formula | C36H30N4O3 |
| Molecular Weight | 566.66 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | (4Z)-5-(4-methoxyphenyl)-4-[[3-(3-methyl-4-prop-2-enoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-2-phenylpyrazol-3-one |
| SMILES | C=CCOc1ccc(-c2nn(-c3ccccc3)cc2/C=C2\C(=O)N(c3ccccc3)N=C2c2ccc(OC)cc2)cc1C |
| InChI | InChI=1S/C36H30N4O3/c1-4-21-43-33-20-17-27(22-25(33)2)34-28(24-39(37-34)29-11-7-5-8-12-29)23-32-35(26-15-18-31(42-3)19-16-26)38-40(36(32)41)30-13-9-6-10-14-30/h4-20,22-24H,1,21H2,2-3H3/b32-23- |
| InChIKey | WLDNIELSEJRETQ-SJIPCVTESA-N |
| XLogP | 7.26 |
| TPSA | 68.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.66 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|