C20H24N2O7S — CID 44623856
[2-(2-adamantylamino)-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate (PubChem CID 44623856) has the molecular formula C20H24N2O7S and a molecular weight of 436.49 g/mol. Its IUPAC name is [2-(2-adamantylamino)-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate.
| Compound Name | [2-(2-adamantylamino)-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 44623856 |
| Molecular Formula | C20H24N2O7S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | [2-(2-adamantylamino)-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate |
| SMILES | CS(=O)(=O)c1ccc(C(=O)OCC(=O)NC2C3CC4CC(C3)CC2C4)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H24N2O7S/c1-30(27,28)17-3-2-13(9-16(17)22(25)26)20(24)29-10-18(23)21-19-14-5-11-4-12(7-14)8-15(19)6-11/h2-3,9,11-12,14-15,19H,4-8,10H2,1H3,(H,21,23) |
| InChIKey | WHAGCJQWGYBKNF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|