C24H32N2O4S — CID 44631498
N-[5-[(4S,5S)-4-(methoxymethyl)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]hexyl]-N-methylbenzenesulfonamide (PubChem CID 44631498) has the molecular formula C24H32N2O4S and a molecular weight of 444.60 g/mol. Its IUPAC name is N-[5-[(4S,5S)-4-(methoxymethyl)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]hexyl]-N-methylbenzenesulfonamide.
| Compound Name | N-[5-[(4S,5S)-4-(methoxymethyl)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]hexyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 44631498 |
| Molecular Formula | C24H32N2O4S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | N-[5-[(4S,5S)-4-(methoxymethyl)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]hexyl]-N-methylbenzenesulfonamide |
| SMILES | COC[C@@H]1N=C(C(C)CCCCN(C)S(=O)(=O)c2ccccc2)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C24H32N2O4S/c1-19(12-10-11-17-26(2)31(27,28)21-15-8-5-9-16-21)24-25-22(18-29-3)23(30-24)20-13-6-4-7-14-20/h4-9,13-16,19,22-23H,10-12,17-18H2,1-3H3/t19?,22-,23-/m0/s1 |
| InChIKey | MWHNCQKUWWVALO-MXQSGTKOSA-N |
| XLogP | 4.30 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|