About 2-phenylfuro[3,2-b]quinoxalin-3-ol
2-phenylfuro[3,2-b]quinoxalin-3-ol (PubChem CID 44631720) has the molecular formula C16H10N2O2
and a molecular weight of 262.27 g/mol. Its IUPAC name is 2-phenylfuro[3,2-b]quinoxalin-3-ol.
Molecular Properties
| Compound Name | 2-phenylfuro[3,2-b]quinoxalin-3-ol |
| PubChem CID | 44631720 |
| Molecular Formula | C16H10N2O2 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 2-phenylfuro[3,2-b]quinoxalin-3-ol |
| SMILES | Oc1c(-c2ccccc2)oc2nc3ccccc3nc12 |
| InChI | InChI=1S/C16H10N2O2/c19-14-13-16(18-12-9-5-4-8-11(12)17-13)20-15(14)10-6-2-1-3-7-10/h1-9,19H |
| InChIKey | YJGVLNYJIJFSPM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-phenylfuro[3,2-b]quinoxalin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylfuro[3,2-b]quinoxalin-3-ol?
The IUPAC name of 2-phenylfuro[3,2-b]quinoxalin-3-ol (CID 44631720) is 2-phenylfuro[3,2-b]quinoxalin-3-ol.
What is the SMILES notation for 2-phenylfuro[3,2-b]quinoxalin-3-ol?
The canonical SMILES for 2-phenylfuro[3,2-b]quinoxalin-3-ol is Oc1c(-c2ccccc2)oc2nc3ccccc3nc12.
What is the InChIKey of 2-phenylfuro[3,2-b]quinoxalin-3-ol?
The InChIKey is YJGVLNYJIJFSPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10N2O2/c19-14-13-16(18-12-9-5-4-8-11(12)17-13)20-15(14)10-6-2-1-3-7-10/h1-9,19H.
What are the key properties of 2-phenylfuro[3,2-b]quinoxalin-3-ol?
2-phenylfuro[3,2-b]quinoxalin-3-ol has a molecular weight of 262.27 g/mol, XLogP of 3.75, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylfuro[3,2-b]quinoxalin-3-ol is sourced from PubChem (CID 44631720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).