C16H10N2O2 — CID 44631720
2-phenylfuro[3,2-b]quinoxalin-3-ol (PubChem CID 44631720) has the molecular formula C16H10N2O2 and a molecular weight of 262.27 g/mol. Its IUPAC name is 2-phenylfuro[3,2-b]quinoxalin-3-ol.
| Compound Name | 2-phenylfuro[3,2-b]quinoxalin-3-ol |
|---|---|
| PubChem CID | 44631720 |
| Molecular Formula | C16H10N2O2 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 2-phenylfuro[3,2-b]quinoxalin-3-ol |
| SMILES | Oc1c(-c2ccccc2)oc2nc3ccccc3nc12 |
| InChI | InChI=1S/C16H10N2O2/c19-14-13-16(18-12-9-5-4-8-11(12)17-13)20-15(14)10-6-2-1-3-7-10/h1-9,19H |
| InChIKey | YJGVLNYJIJFSPM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |