C23H34O2Si — CID 44632264
1-[2-methyl-2-[3-tri(propan-2-yl)silylprop-2-ynyl]-3H-1-benzofuran-5-yl]ethanone (PubChem CID 44632264) has the molecular formula C23H34O2Si and a molecular weight of 370.61 g/mol. Its IUPAC name is 1-[2-methyl-2-[3-tri(propan-2-yl)silylprop-2-ynyl]-3H-1-benzofuran-5-yl]ethanone.
| Compound Name | 1-[2-methyl-2-[3-tri(propan-2-yl)silylprop-2-ynyl]-3H-1-benzofuran-5-yl]ethanone |
|---|---|
| PubChem CID | 44632264 |
| Molecular Formula | C23H34O2Si |
| Molecular Weight | 370.61 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | 1-[2-methyl-2-[3-tri(propan-2-yl)silylprop-2-ynyl]-3H-1-benzofuran-5-yl]ethanone |
| SMILES | CC(=O)c1ccc2c(c1)CC(C)(CC#C[Si](C(C)C)(C(C)C)C(C)C)O2 |
| InChI | InChI=1S/C23H34O2Si/c1-16(2)26(17(3)4,18(5)6)13-9-12-23(8)15-21-14-20(19(7)24)10-11-22(21)25-23/h10-11,14,16-18H,12,15H2,1-8H3 |
| InChIKey | YSAOBYOGHWSDEI-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.61 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|