C30H47NO9 — CID 44632379
(2R,3S,5R,6S,7R)-2-(dibenzylamino)-3,5,6,7-tetrakis(methoxymethoxy)octan-1-ol (PubChem CID 44632379) has the molecular formula C30H47NO9 and a molecular weight of 565.70 g/mol. Its IUPAC name is (2R,3S,5R,6S,7R)-2-(dibenzylamino)-3,5,6,7-tetrakis(methoxymethoxy)octan-1-ol.
| Compound Name | (2R,3S,5R,6S,7R)-2-(dibenzylamino)-3,5,6,7-tetrakis(methoxymethoxy)octan-1-ol |
|---|---|
| PubChem CID | 44632379 |
| Molecular Formula | C30H47NO9 |
| Molecular Weight | 565.70 g/mol |
| Exact Mass | 565.33 |
| IUPAC Name | (2R,3S,5R,6S,7R)-2-(dibenzylamino)-3,5,6,7-tetrakis(methoxymethoxy)octan-1-ol |
| SMILES | COCO[C@@H]([C@@H](C)OCOC)[C@@H](C[C@H](OCOC)[C@@H](CO)N(Cc1ccccc1)Cc1ccccc1)OCOC |
| InChI | InChI=1S/C30H47NO9/c1-24(37-20-33-2)30(40-23-36-5)29(39-22-35-4)16-28(38-21-34-3)27(19-32)31(17-25-12-8-6-9-13-25)18-26-14-10-7-11-15-26/h6-15,24,27-30,32H,16-23H2,1-5H3/t24-,27-,28+,29-,30+/m1/s1 |
| InChIKey | VKCKUJNCEHZZFE-RVARMHLQSA-N |
| XLogP | 3.42 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.70 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|